| Catalog Number |
ACM1246833260 |
| CAS |
1246833-26-0 |
| Structure |
 |
| Synonyms |
[2H6]-Curcumin |
| IUPAC Name |
(1E,6E)-1,7-bis[4-hydroxy-3-(trideuteriomethoxy)phenyl]hepta-1,6-diene-3,5-dione |
| Molecular Weight |
374.42 |
| Molecular Formula |
C21H14D6O6 |
| InChI |
InChI=1S/C21H20O6/c1-26-20-11-14(5-9-18(20)24)3-7-16(22)13-17(23)8-4-15-6-10-19(25)21(12-15)27-2/h3-12,24-25H,13H2,1-2H3/b7-3+,8-4+/i1D3,2D3 |
| InChI Key |
VFLDPWHFBUODDF-BQWNYRPNSA-N |
| Melting Point |
184-186 °C |
| Appearance |
Orange solid |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C(OC1=C(C=CC(=C1)/C=C/C(=O)CC(=O)/C=C/C2=CC(=C(C=C2)O)OC([2H])([2H])[2H])O)([2H])[2H] |
| Isotopic Enrichment |
99 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
458-37-7 |
| Unlabeled Synonyms |
(E,E)-1,7-Bis(4-hydroxy-3-methoxyphenyl)-1,6-heptadiene-3,5-dione; Diferuloylmethane |
