2-Chlorophenol D4 (3,4,5,6 D4) 100 µg/mL in Acetone
| Catalog Number |
ACM93951736-1 |
| CAS |
93951-73-6 |
| Structure |
 |
| Synonyms |
Phen-2,3,4,5-d4-ol, 6-chloro- (9CI), 2-Chlorophenol D4, 2-Chlorophenol (ring-D4), 2-Chloro-3,4,5,6-tetradeuteriophenol |
| IUPAC Name |
2-chloro-3,4,5,6-tetradeuteriophenol |
| Molecular Weight |
132.58 |
| Molecular Formula |
C6D4HClO |
| Canonical SMILES |
[2H]c1c([2H])c([2H])c(Cl)c(O)c1[2H] |
| InChI |
InChI=1S/C6H5ClO/c7-5-3-1-2-4-6(5)8/h1-4,8H/i1D,2D,3D,4D |
| Storage |
+20 °C |
| Accurate Mass |
132.028 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
