4-Chloroaniline-2,6-d2 (98 atom % D, min 98% Chemical Purity)
| Catalog Number |
ACM35749941-1 |
| CAS |
35749-94-1 |
| Structure |
 |
| Synonyms |
4-Chloroaniline-2,6-D2, 4-Chloroaniline D2 (phenyl 2,6 D2), Benzen-2,6-d2-amine, 4-chloro-, 4-Chloroaniline-2,6-d2, 4-Chlorobenzen-2,6-d2-amine |
| IUPAC Name |
4-chlorobenzen-2,6-d2-amine |
| Molecular Weight |
129.58 |
| Molecular Formula |
C₆H₄D₂ClN |
| Canonical SMILES |
ClC1=CC([2H])=C(C([2H])=C1)N |
| InChI |
InChI=1S/C6H6ClN/c7-5-1-3-6(8)4-2-5/h1-4H,8H2/i3D,4D |
| Accurate Mass |
129.03 |
| Alternative CAS |
106-47-8 |
| Format |
Neat |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
