Carbendazim D4 (phenyl D4)
| Catalog Number |
ACM291765952-2 |
| CAS |
291765-95-2 |
| Structure |
 |
| IUPAC Name |
methyl N-(4,5,6,7-tetradeuterio-1H-benzimidazol-2-yl)carbamate |
| Molecular Weight |
195.21 |
| Molecular Formula |
C9D4H5N3O2 |
| Canonical SMILES |
[2H]c1c([2H])c([2H])c2[nH]c(NC(=O)OC)nc2c1[2H] |
| InChI |
InChI=1S/C9H9N3O2/c1-14-9(13)12-8-10-6-4-2-3-5-7(6)11-8/h2-5H,1H3,(H2,10,11,12,13)/i2D,3D,4D,5D |
| Storage |
+20 °C |
| Accurate Mass |
195.0946 |
| Alternative CAS |
10605-21-7 |
| Format |
Neat |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
