Carbaryl D3 (methyl D3) 100 µg/mL in Cyclohexane
| Catalog Number |
ACM1433961568-1 |
| CAS |
1433961-56-8 |
| Structure |
 |
| Synonyms |
Carbaryl D3 (methyl D3) |
| IUPAC Name |
naphthalen-1-yl N-(trideuteriomethyl)carbamate |
| Molecular Weight |
204.24 |
| Molecular Formula |
C12D3H8NO2 |
| Canonical SMILES |
[2H]C([2H])([2H])NC(=O)Oc1cccc2ccccc12 |
| InChI |
InChI=1S/C12H11NO2/c1-13-12(14)15-11-8-4-6-9-5-2-3-7-10(9)11/h2-8H,1H3,(H,13,14)/i1D3 |
| Storage |
+20 °C |
| Accurate Mass |
204.0978 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
