| Catalog Number |
ACM285132889-1 |
| CAS |
285132-88-9 |
| Structure |
 |
| Synonyms |
p-Aminophenol; 4-Hydroxyaniline |
| IUPAC Name |
N,N,2,3,5,6-hexadeuterio-4-deuteriooxyaniline |
| Molecular Weight |
116.17 |
| Molecular Formula |
C6D7NO |
| Canonical SMILES |
[2H]Oc1c([2H])c([2H])c(N([2H])[2H])c([2H])c1[2H] |
| InChI |
InChI=1S/C6H7NO/c7-5-1-3-6(8)4-2-5/h1-4,8H,7H2/i1D,2D,3D,4D/hD3 |
| Purity |
97 atom % D |
| Accurate Mass |
116.0967 |
| Format |
Neat |
| Functional Group |
Alcohols & Phenols,Amines & Amine Salts |
| Isotopic Enrichment |
97 atom % D |
| Packaging |
0.5 g
In Stock
1 g
In Stock |
| Shipping Hazards |
TOXIC (PGIII) |
| SIL Type |
Deuterium |
| Stability |
Stable if stored under recommended conditions (see section 7 of SDS). After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
123-30-8 |
