1-Aminonaphthalene D7 100 µg/mL in Methanol
| Catalog Number |
ACM78832538-1 |
| CAS |
78832-53-8 |
| Structure |
 |
| IUPAC Name |
2,3,4,5,6,7,8-heptadeuterionaphthalen-1-amine |
| Molecular Weight |
150.23 |
| Molecular Formula |
C10D7H2N |
| Canonical SMILES |
[2H]c1c([2H])c([2H])c2c(N)c([2H])c([2H])c([2H])c2c1[2H] |
| InChI |
InChI=1S/C10H9N/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H,11H2/i1D,2D,3D,4D,5D,6D,7D |
| Storage |
+20 °C |
| Accurate Mass |
150.1174 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
| Unlabeled CAS |
134-32-7 |
Please kindly note that our products and services are for research use only.
