AHTN D3 (acetyl D3) 100 µg/mL in Isooctane
| Catalog Number |
ACM1396967820-1 |
| CAS |
1396967-82-0 |
| Structure |
 |
| IUPAC Name |
2,2,2-trideuterio-1-(3,5,5,6,8,8-hexamethyl-6,7-dihydronaphthalen-2-yl)ethanone |
| Molecular Weight |
261.42 |
| Molecular Formula |
C18D3H23O |
| Canonical SMILES |
[2H]C([2H])([2H])C(=O)c1cc2c(cc1C)C(C)(C)C(C)CC2(C)C |
| InChI |
InChI=1S/C18H26O/c1-11-8-16-15(9-14(11)13(3)19)17(4,5)10-12(2)18(16,6)7/h8-9,12H,10H2,1-7H3/i3D3 |
| Storage |
+20 °C |
| Accurate Mass |
261.2172 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
