| Catalog Number |
ACM81586983 |
| CAS |
81586-98-3 |
| Structure |
 |
| Synonyms |
3,4-Dihydroxy-1,3,5(10)-estratrien-17-one-d4 |
| IUPAC Name |
(8R,9S,13S,14S)-1,2,16,16-tetradeuterio-3,4-dihydroxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-one |
| Molecular Weight |
290.39 |
| Molecular Formula |
C18H18D4O3 |
| InChI |
InChI=1S/C18H22O3/c1-18-9-8-11-10-4-6-15(19)17(21)13(10)3-2-12(11)14(18)5-7-16(18)20/h4,6,11-12,14,19,21H,2-3,5,7-9H2,1H3/t11-,12-,14+,18+/m1/s1/i4D,6D,7D2 |
| InChI Key |
XQZVQQZZOVBNLU-RFZGAVBWSA-N |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=C(C(=C(C2=C1[C@H]3CC[C@]4([C@H]([C@@H]3CC2)CC(C4=O)([2H])[2H])C)O)O)[2H] |
| Isotopic Enrichment |
99 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store refrigerated |
| Unlabeled CAS |
3131-23-5 |
| Unlabeled Synonyms |
1,3,5(10)-Estratrien-3,4-diol-17-one |
