Catalog Number |
ACM298704220 |
CAS |
298704-22-0 |
Structure |
|
Synonyms |
[2H5]-4-Hydroxybenzaldehyde |
IUPAC Name |
deuterio-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)methanone |
Molecular Weight |
127.15 |
Molecular Formula |
C7HD5O2 |
InChI |
InChI=1S/C7H6O2/c8-5-6-1-3-7(9)4-2-6/h1-5,9H/i1D,2D,3D,4D,5D |
InChI Key |
RGHHSNMVTDWUBI-RALIUCGRSA-N |
Chemical Formula |
HOC6D4CDO |
Hazards |
Non-hazardous for transport. |
Isomeric SMILES |
[2H]C1=C(C(=C(C(=C1C(=O)[2H])[2H])[2H])O)[2H] |
Isotopic Enrichment |
99 atom % D |
Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
Storage Conditions |
Store at room temperature |
Unlabeled CAS |
123-08-0 |
Unlabeled Synonyms |
p-Hydroxybenzaldehyde |