| Catalog Number |
ACM7329524-1 |
| CAS |
7329-52-4 |
| Structure |
 |
| Synonyms |
D4-2-Methoxyphenol |
| IUPAC Name |
2,3,4,5-tetradeuterio-6-methoxyphenol |
| Molecular Weight |
128.16 |
| Molecular Formula |
C7H4D4O2 |
| InChI |
InChI=1S/C7H8O2/c1-9-7-5-3-2-4-6(7)8/h2-5,8H,1H3/i2D,3D,4D,5D |
| InChI Key |
LHGVFZTZFXWLCP-QFFDRWTDSA-N |
| Chemical Formula |
CH3OC6D4OH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=C(C(=C(C(=C1[2H])O)OC)[2H])[2H] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
90-05-1 |
| Unlabeled Synonyms |
Guaiacol; 2-Hydroxyanisole |
