| Catalog Number |
ACM1219795251 |
| CAS |
1219795-25-1 |
| Structure |
 |
| Synonyms |
2-Methoxynaphthalene-d7 |
| IUPAC Name |
1,2,3,4,5,6,8-heptadeuterio-7-methoxynaphthalene |
| Molecular Weight |
165.24 |
| Molecular Formula |
C11H3D7O |
| InChI |
InChI=1S/C11H10O/c1-12-11-7-6-9-4-2-3-5-10(9)8-11/h2-8H,1H3/i2D,3D,4D,5D,6D,7D,8D |
| InChI Key |
LUZDYPLAQQGJEA-CFWCETGYSA-N |
| Purity |
98 atom % D |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=C(C(=C2C(=C(C(=C(C2=C1[2H])[2H])[2H])OC)[2H])[2H])[2H] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
93-04-9 |
| Unlabeled Synonyms |
Methyl β-napthyl ether; Nerolin |
