| Catalog Number |
ACM949885909 |
| CAS |
949885-90-9 |
| Structure |
 |
| Synonyms |
(8R,9S,13S,14S)-1,4,6-Trideuterio-3-deuteriooxy-2-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| IUPAC Name |
(8R,9S,13S,14S)-1,4,6-trideuterio-3-deuteriooxy-2-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| Molecular Weight |
304.42 |
| Molecular Formula |
C19H20D4O3 |
| InChI |
InChI=1S/C19H24O3/c1-19-8-7-12-13(15(19)5-6-18(19)21)4-3-11-9-16(20)17(22-2)10-14(11)12/h9-10,12-13,15,20H,3-8H2,1-2H3/t12-,13+,15-,19-/m0/s1/i3D,9D,10D/hD/t3?,12-,13+,15-,19- |
| InChI Key |
WHEUWNKSCXYKBU-NZTFOOEBSA-N |
| Purity |
99 atom % D |
| Exact Mass |
300.17300 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1C[C@@H]2[C@H](CC[C@]3([C@H]2CCC3=O)C)C4=C(C(=C(C(=C14)[2H])O[2H])OC)[2H] |
| Isotopic Enrichment |
99 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store refrigerated |
| CAS (Unlabeled) |
362-08-3 |
| Synonyms (Unlabeled) |
1,3,5(10)-estratrien-2,3-diol-17-one 2-Methyl Ether; 3-Hydroxy-2-methoxyestra-1,3,5(10)-trien-17-one |
