| Catalog Number |
ACM1065473053 |
| CAS |
1065473-05-3 |
| Structure |
 |
| Synonyms |
[2H7]-Guaiacol; 2-Methoxy-D3-phenol-D4 |
| IUPAC Name |
2,3,4,5-tetradeuterio-6-(trideuteriomethoxy)phenol |
| Molecular Weight |
131.18 |
| Molecular Formula |
C7H4D4O2 |
| InChI |
InChI=1S/C7H8O2/c1-9-7-5-3-2-4-6(7)8/h2-5,8H,1H3/i1D3,2D,3D,4D,5D |
| InChI Key |
LHGVFZTZFXWLCP-AAYPNNLASA-N |
| Purity |
98 atom % D |
| Chemical Formula |
CD3OC6D4OH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=C(C(=C(C(=C1[2H])O)OC([2H])([2H])[2H])[2H])[2H] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
90-05-1 |
| Unlabeled Synonyms |
Guaiacol; 2-Hydroxyanisole |
