Catalog Number |
ACM40632233 |
CAS |
40632-23-3 |
Structure |
|
IUPAC Name |
5,6-dideuterio-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
Molecular Weight |
230.22 |
Molecular Formula |
C9H10D2N2O5 |
InChI |
InChI=1S/C9H12N2O5/c12-4-6-5(13)3-8(16-6)11-2-1-7(14)10-9(11)15/h1-2,5-6,8,12-13H,3-4H2,(H,10,14,15)/t5-,6+,8+/m0/s1/i1D,2D |
InChI Key |
MXHRCPNRJAMMIM-AQAQJVFASA-N |
Hazards |
Non-hazardous for transport. |
Isomeric SMILES |
[2H]C1=C(N(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)CO)O)[2H] |
Isotopic Enrichment |
98 atom % D |
Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
Storage Conditions |
Store at room temperature |
Unlabeled CAS |
951-78-0 |
Unlabeled Synonyms |
1-(2-Deoxy-β-D-ribofuranosyl)uracil |