| Catalog Number |
ACM369656768-1 |
| CAS |
369656-76-8 |
| Structure |
 |
| Synonyms |
1-(2-Deoxy-b-D-erythro-pentofuranosyl)uracil-13C,15N2 |
| IUPAC Name |
1-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl](2-13C,1,3-15N2)pyrimidine-2,4-dione |
| Molecular Weight |
231.23 |
| Molecular Formula |
13CC8H1215N2O5 |
| InChI |
InChI=1S/C9H12N2O5/c12-4-6-5(13)3-8(16-6)11-2-1-7(14)10-9(11)15/h1-2,5-6,8,12-13H,3-4H2,(H,10,14,15)/t5-,6-,8-/m1/s1/i9+1,10+1,11+1 |
| InChI Key |
MXHRCPNRJAMMIM-BRNXEOTRSA-N |
| Appearance |
White solid |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
C1[C@H]([C@H](O[C@H]1[15N]2C=CC(=O)[15NH][13C]2=O)CO)O |
| Isotopic Enrichment |
99 atom % 13C; 99 atom % 15N |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
951-78-0 |
| Unlabeled Synonyms |
1-(2-Deoxy-β-D-ribofuranosyl)uracil |
