Catalog Number |
ACM129522812-1 |
CAS |
129522-81-2 |
Structure |
 |
Synonyms |
Beta-D-Glucopyranoside, octyl-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-D17 |
IUPAC Name |
(2R,3R,4S,5S,6R)-2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecadeuteriooctoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
Molecular Weight |
309.48 |
Molecular Formula |
C14D17H11O6 |
InChI |
InChI=1S/C14H28O6/c1-2-3-4-5-6-7-8-19-14-13(18)12(17)11(16)10(9-15)20-14/h10-18H,2-9H2,1H3/t10-,11-,12+,13-,14-/m1/s1/i1D3,2D2,3D2,4D2,5D2,6D2,7D2,8D2 |
InChI Key |
HEGSGKPQLMEBJL-LNYSLXKBSA-N |
Purity |
97% |
Hazards |
Non-hazardous for transport. |
Isomeric SMILES |
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Isotopic Enrichment |
98 atom % D |
Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
Storage Conditions |
Store at room temperature |
CAS (Unlabeled) |
29836-26-8 |
Synonyms (Unlabeled) |
n-Octyl glucoside |