| Catalog Number |
ACM1331655505-1 |
| CAS |
1331655-50-5 |
| Structure |
 |
| Synonyms |
1-[10-[3-(Bis(trideuteriomethyl)amino)propyl]phenothiazin-2-yl]ethanone, but-2-enedioic acid, Acepromazine D6 Maleate (N,N-dimethyl-D6), Acepromazine-d6 Maleate |
| IUPAC Name |
1-[10-[3-[bis(trideuteriomethyl)amino]propyl]phenothiazin-2-yl]ethanone;maleic acid |
| Molecular Weight |
448.56 |
| Molecular Formula |
C19D6H16N2OS·C4H4O4 |
| Canonical SMILES |
[2H]C([2H])([2H])N(CCCN1c2ccccc2Sc3ccc(cc13)C(=O)C)C([2H])([2H])[2H].OC(=O)\C=C/C(=O)O |
| Storage |
+20 °C |
| Accurate Mass |
448.1939 |
| Format |
Neat |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
| Unlabeled CAS |
3598-37-6 |
Please kindly note that our products and services are for research use only.
