| Catalog Number |
ACM20666608 |
| CAS |
20666-60-8 |
| Structure |
 |
| Synonyms |
2,4(1H,3H)-Pyrimidinedione-1,3-d2 |
| IUPAC Name |
1,3-dideuteriopyrimidine-2,4-dione |
| Molecular Weight |
114.10 |
| Molecular Formula |
C4H2D2N2O2 |
| InChI |
InChI=1S/C4H4N2O2/c7-3-1-2-5-4(8)6-3/h1-2H,(H2,5,6,7,8)/i/hD2 |
| InChI Key |
ISAKRJDGNUQOIC-ZSJDYOACSA-N |
| Purity |
98 atom % D |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]N1C=CC(=O)N(C1=O)[2H] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
66-22-8 |
| Unlabeled Synonyms |
2,4-(1H,3H)-Pyrimidinedione; 2,4-Dihydroxypyrimidine; 2,4-Pyrimidinediol |
