Sodium acetate (1,2-13C2; D3)
| Catalog Number |
ACM123333802-1 |
| CAS |
123333-80-2 |
| Structure |
 |
| Synonyms |
Sodium acetate-13C2,D3 |
| IUPAC Name |
sodium;2,2,2-trideuterioacetate |
| Molecular Weight |
87.04 |
| Molecular Formula |
13C2D3NaO2 |
| InChI |
InChI=1S/C2H4O2.Na/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1/i1+1D3,2+1; |
| InChI Key |
VMHLLURERBWHNL-SZRYOQPCSA-M |
| Melting Point |
>300 °C (>572 °F) |
| Flash Point |
>250 °C (>482 °F)-closed cup |
| Density |
1.528 g/cm3 |
| Solubility |
Water: 246 g/L at 20 °C (68 °F)-completely soluble |
| Appearance |
White powder |
| Chemical Formula |
*CD3*COONa |
| Chemical Purity |
98% |
| Isomeric SMILES |
[2H][13C]([2H])([2H])[13C](=O)[O-].[Na+] |
| Isotopic Enrichment |
99 atom % 13C; 98 atom % D |
| pH |
8.5-9.9 at 246 g/L at 25 °C (77 °F) |
| Stability |
Stable if stored under recommended conditions. |
| Unlabeled CAS |
127-09-3 |
Please kindly note that our products and services are for research use only.
