D-Glucose (1-13C; 6-13C; 6,6-D2)
| Catalog Number |
ACM157171807-1 |
| CAS |
157171-80-7 |
| Structure |
 |
| Synonyms |
D-Glucose-1,6-13C2-6-C-d2; D-[1,6-13C2;6,6'-2H2]glucose |
| IUPAC Name |
(3R,4S,5S,6R)-6-[dideuterio(hydroxy)(1-13C)methyl](2-13C)oxane-2,3,4,5-tetrol |
| Molecular Weight |
184.15 |
| Molecular Formula |
13C2C4D2H10O6 |
| InChI |
InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5-,6?/m1/s1/i1+1D2,6+1 |
| InChI Key |
WQZGKKKJIJFFOK-SPUBNPLKSA-N |
| Melting Point |
150-152 °C (302-306 °F) |
| Appearance |
White crystalline/powder |
| Chemical Formula |
C4*C2H10D2O6 |
| Chemical Purity |
98% |
| Isotopic Enrichment |
97+ atom % 13C; 98 atom % D |
| Stability |
Stable if stored under recommended conditions. |
| Unlabeled CAS |
50-99-7 |
| Unlabeled Synonyms |
Dextrose |
Please kindly note that our products and services are for research use only.
