Alpha-Ketobutyric acid, sodium salt (Methyl-13C; 3,3-D2)
| Catalog Number |
ACM1189500693 |
| CAS |
1189500-69-3 |
| Synonyms |
Sodium:3,3-dideuterio-2-oxobutanoate; Alpha-Ketobutyric acid-13C,D2 sodium Salt |
| IUPAC Name |
sodium;3,3-dideuterio-2-oxo(4-13C)butanoate |
| Molecular Weight |
127.08 |
| Molecular Formula |
C4H3D2NaO3 |
| Canonical SMILES |
[2H]C([2H])([13CH3])C(=O)C(=O)[O-].[Na+] |
| InChI |
InChI=1S/C4H6O3.Na/c1-2-3(5)4(6)7;/h2H2,1H3,(H,6,7);/q;+1/p-1/i1+1,2D2; |
| InChI Key |
SUAMAHKUSIHRMR-ASMGDNRJSA-M |
| Melting Point |
210 °C (410 °F) |
| Appearance |
White to beige powder |
| Chemical Formula |
*CH3CD2COCOONa |
| Chemical Purity |
98% |
| Isomeric SMILES |
[2H]C([2H])([13CH3])C(=O)C(=O)[O-].[Na+] |
| Isotopic Enrichment |
99 atom % 13C; 98 atom % D |
| Stability |
Two years after receipt. Re-QC after 2 years. |
| Unlabeled CAS |
2013-26-5 |
| Unlabeled Synonyms |
2-Oxybutanoic acidsodium salt; Sodium alpha-ketobutyrate; 2-Oxybutyric acidsodium salt |
Please kindly note that our products and services are for research use only.
