| Catalog Number |
ACM109923504 |
| CAS |
109923-50-4 |
| Structure |
 |
| Synonyms |
9-β-D-Ribofuranosyladenine |
| IUPAC Name |
(2R,3R,4S,5R)-2-(2-deuterio-6-imino-3H-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| Molecular Weight |
268.25 |
| Molecular Formula |
C10H12DN5O4 |
| InChI |
InChI=1S/C10H13N5O4/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13)/t4-,6-,7-,10-/m1/s1/i2D |
| InChI Key |
OIRDTQYFTABQOQ-ASCSKKCOSA-N |
| Melting Point |
233-234 °C |
| Purity |
98 atom % D |
| Exact Mass |
268.10300 |
| Functional Group |
Alcohols & Phenols,Amines & Amine Salts,Heterocycles |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=NC(=N)C2=C(N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O |
| Isotopic Enrichment |
98 atom % D |
| Packaging |
0.01 g
In Stock
0.05 g
In Stock |
| Shipping Hazards |
NON-HAZARDOUS FOR TRANSPORT |
| Stability |
Stable if stored under recommended conditions (see section 7 of SDS). After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
58-61-7 |
| Unlabeled Synonyms |
9-β-D-Ribofuranosyladenine |
