3-Methyladenine (Methyl-D3)
| Catalog Number |
ACM110953394-1 |
| CAS |
110953-39-4 |
| Synonyms |
3-Methyladenine-D3; 3-Methyl-D3-adenine |
| IUPAC Name |
3-(trideuteriomethyl)-7H-purin-6-imine |
| Molecular Weight |
152.17 |
| Molecular Formula |
C6H4D3N5 |
| InChI |
InChI=1S/C6H7N5/c1-11-3-10-5(7)4-6(11)9-2-8-4/h2-3,7H,1H3,(H,8,9)/i1D3 |
| InChI Key |
ZPBYVFQJHWLTFB-FIBGUPNXSA-N |
| Melting Point |
300 °C (572 °F) (lit.) |
| Appearance |
White powder |
| Chemical Purity |
98% |
| Isomeric SMILES |
[2H]C([2H])([2H])N1C=NC(=N)C2=C1N=CN2 |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. |
| Unlabeled CAS |
5142-23-4 |
| Unlabeled Synonyms |
6-Amino-3-methylpurine |
Please kindly note that our products and services are for research use only.
