1,3-Dimethyluric acid (2,4,5,6-13C4; 1,3,9-15N3)
| Catalog Number |
ACM1173019163 |
| CAS |
1173019-16-3 |
| Synonyms |
1,3-Dimethyluric acid-13C4,15N3; 1,3-Dimethyluric acid-2,4,5,6-13C4-1,3,9-15N3 |
| Molecular Weight |
203.11 |
| Molecular Formula |
13C4C3H815N3NO3 |
| InChI |
InChI=1S/C7H8N4O3/c1-10-4-3(8-6(13)9-4)5(12)11(2)7(10)14/h1-2H3,(H2,8,9,13)/i3+1,4+1,5+1,7+1,9+1,10+1,11+1 |
| InChI Key |
OTSBKHHWSQYEHK-JCRQFRHWSA-N |
| Melting Point |
300 °C (572 °F) |
| Appearance |
Light yellow
solid |
| Chemical Purity |
98% |
| Isomeric SMILES |
C[15N]1[13C]2=[13C]([13C](=O)[15N]([13C]1=O)C)NC(=O)[15NH]2 |
| Isotopic Enrichment |
99 atom % 13C; 98 atom % 15N |
| Stability |
Stable if stored under recommended conditions. |
| Unlabeled CAS |
944-73-0 |
Please kindly note that our products and services are for research use only.
