(±)-Warfarin D5 (phenyl D5) 100 µg/mL in Acetonitrile
| Catalog Number |
ACMA00064498 |
| Synonyms |
(±)-Warfarin D5 (phenyl-D5), 2H-1-Benzopyran-2-one, 4-hydroxy-3-[3-oxo-1-(phenyl-d5)butyl]- (9CI), (±)-4-Hydroxy-3-[3-oxo-1-(phenyl-d5)butyl]-2H-1-benzopyran-2-one |
| IUPAC Name |
4-hydroxy-3-[3-oxo-1-(2,3,4,5,6-pentadeuteriophenyl)butyl]chromen-2-one |
| Molecular Weight |
313.36 |
| Molecular Formula |
C19D5H11O4 |
| Canonical SMILES |
[2H]c1c([2H])c([2H])c(C(CC(=O)C)C2=C(O)c3ccccc3OC2=O)c([2H])c1[2H] |
| InChI |
InChI=1S/C19H16O4/c1-12(20)11-15(13-7-3-2-4-8-13)17-18(21)14-9-5-6-10-16(14)23-19(17)22/h2-10,15,21H,11H2,1H3/i2D,3D,4D,7D,8D |
| Storage |
+20 °C |
| Accurate Mass |
313.1362 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
| Unlabeled CAS |
81-81-2 |
Please kindly note that our products and services are for research use only.
