| Catalog Number |
ACM74495742-2 |
| CAS |
74495-74-2 |
| Synonyms |
[Methoxy-2H3]-Vanillin |
| IUPAC Name |
4-hydroxy-3-(trideuteriomethoxy)benzaldehyde |
| Molecular Weight |
155.17 |
| Molecular Formula |
C8H5D3O3 |
| InChI |
InChI=1S/C8H8O3/c1-11-8-4-6(5-9)2-3-7(8)10/h2-5,10H,1H3/i1D3 |
| InChI Key |
MWOOGOJBHIARFG-FIBGUPNXSA-N |
| Appearance |
Off-white solid |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])OC1=C(C=CC(=C1)C=O)O |
| Isotopic Enrichment |
99 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
121-33-5 |
| Unlabeled Synonyms |
4-Hydroxy-3-methoxybenzaldehyde |
