Valproic acid (Propyl-1,1-D2, pentanoic-3,3-D2)
| Catalog Number |
ACM87745173-1 |
| CAS |
87745-17-3 |
| Structure |
 |
| Synonyms |
2-pentanoic-d2 acid |
| IUPAC Name |
3,3-dideuterio-2-(1,1-dideuteriopropyl)pentanoic acid |
| Molecular Weight |
148.24 |
| Molecular Formula |
C8H12D4O2 |
| InChI |
InChI=1S/C8H16O2/c1-3-5-7(6-4-2)8(9)10/h7H,3-6H2,1-2H3,(H,9,10)/i5D2,6D2 |
| InChI Key |
NIJJYAXOARWZEE-NZLXMSDQSA-N |
| Boiling Point |
220 °C (428 °F) |
| Flash Point |
111 °C (232 °F)-closed cup |
| Purity |
98% |
| Density |
0.9 g/mL at 25 °C (77 °F) |
| Solubility |
Water: 2 g/L-slightly soluble |
| Appearance |
Colourless liquid |
| Chemical Formula |
(CH3CH2CD2)2CHCO2H |
| Isomeric SMILES |
[2H]C([2H])(CC)C(C(=O)O)C([2H])([2H])CC |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. |
| Unlabeled CAS |
99-66-1 |
| Unlabeled Synonyms |
2-Propylpentanoic acid |
Please kindly note that our products and services are for research use only.
