Catalog Number |
ACM40632211 |
CAS |
40632-21-1 |
Structure |
|
Synonyms |
[5,6-2H2]-Uridine |
IUPAC Name |
5,6-dideuterio-1-[(2R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
Molecular Weight |
246.22 |
Molecular Formula |
C9H10D2N2O6 |
Canonical SMILES |
C1=CN(C(=O)NC1=O)C2C(C(C(O2)CO)O)O |
InChI |
InChI=1S/C9H12N2O6/c12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16/h1-2,4,6-8,12,14-15H,3H2,(H,10,13,16)/t4-,6+,7?,8-/m1/s1/i1D,2D |
InChI Key |
DRTQHJPVMGBUCF-TTYVMISXSA-N |
Melting Point |
162-164 °C |
Purity |
97-98 atom % D |
Density |
1.689g/cm³ |
Appearance |
White solid |
Exact Mass |
246.08200 |
Hazards |
Non-hazardous for transport. |
Isomeric SMILES |
[2H]C1=C(N(C(=O)NC1=O)[C@H]2C([C@H]([C@H](O2)CO)O)O)[2H] |
Isotopic Enrichment |
98 atom % D |
Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
Storage Conditions |
Store at room temperature |
Unlabeled CAS |
58-96-8 |
Unlabeled Synonyms |
1-β-D-Ribofuranosyluracil |