| Catalog Number |
ACM92487688-2 |
| CAS |
92487-68-8 |
| Structure |
 |
| Description |
Uridine is a pyrimidine nucleoside with uracil serving as its nucleobase. It is a building block for RNA nucleotides and can be used as an isotopically labeled precursor. |
| Synonyms |
Uridine-1,3-15N2; Uracil, 1-β-D-ribofuranosyl-; 1-β-D-Ribofuranosyl-2,4(1H,3H)-pyrimidinedione; 1-β-D-Ribofuranosyluracil; Uridin; β-D-Ribofuranoside, 2,4(1H,3H)-pyrimidinedione-1; β-Uridine |
| Molecular Weight |
246.19 |
| Molecular Formula |
C9H1215N2O6 |
| Canonical SMILES |
O[C@H]1[C@@H](O)[C@H]([15N](C=C2)C([15NH]C2=O)=O)O[C@@H]1CO |
| InChI |
1S/C9H12N2O6/c12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16/h1-2,4,6-8,12,14-15H,3H2,(H,10,13,16)/t4-,6-,7-,8-/m1/s1/i10+1,11+1 |
| InChI Key |
DRTQHJPVMGBUCF-DMNIUWJGSA-N |
| Purity |
98% (CP) |
| Appearance |
solid |
| Application |
Biomolecular NMR, Genetic Therapy |
| Storage |
Store at 2-8°C |
| EC Number |
200-407-5 (Unlabeled) |
| Isotopic Enrichment |
98 atom % 15N |
| Mass Shift |
M+2 |
| MDL Number |
MFCD00145512 |
| Type |
Ribonucleosides- 15N |
| Unlabeled CAS |
58-96-8 |
