| Catalog Number |
ACM24897527-1 |
| CAS |
24897-52-7 |
| Structure |
 |
| Synonyms |
Dideuterouracil |
| IUPAC Name |
5,6-dideuterio-1H-pyrimidine-2,4-dione |
| Molecular Weight |
114.1 |
| Molecular Formula |
C4D2H2N2O2 |
| Canonical SMILES |
[2H]C1=C([2H])C(=O)NC(=O)N1 |
| InChI |
InChI=1S/C4H4N2O2/c7-3-1-2-5-4(8)6-3/h1-2H,(H2,5,6,7,8)/i1D,2D |
| InChI Key |
ISAKRJDGNUQOIC-QDNHWIQGSA-N |
| Purity |
98 atom % D |
| Storage |
-20 °C |
| Accurate Mass |
114.0398 |
| Alternative CAS |
66-22-8 |
| Format |
Neat |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=C(NC(=O)NC1=O)[2H] |
| Isotopic Enrichment |
98 atom % D |
| Shipping Temperature |
Room temperature |
| SIL Type |
Deuterium |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
66-22-8 |
| Unlabeled Synonyms |
2,4-(1H,3H)-Pyrimidinedione; 2,4-Dihydroxypyrimidine; 2,4-Pyrimidinediol |
