| Catalog Number |
ACM24897516-1 |
| CAS |
24897-51-6 |
| Structure |
 |
| Synonyms |
6-Deuterouracil |
| IUPAC Name |
6-deuterio-1H-pyrimidine-2,4-dione |
| Molecular Weight |
113.09 |
| Molecular Formula |
C4H3DN2O2 |
| InChI |
InChI=1S/C4H4N2O2/c7-3-1-2-5-4(8)6-3/h1-2H,(H2,5,6,7,8)/i2D |
| InChI Key |
ISAKRJDGNUQOIC-VMNATFBRSA-N |
| Melting Point |
320-322 °C (dec.) |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=CC(=O)NC(=O)N1 |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
66-22-8 |
| Unlabeled Synonyms |
2,4-(1H,3H)-Pyrimidinedione; 2,4-Dihydroxypyrimidine; 2,4-Pyrimidinediol |
