| Catalog Number |
ACM60658404-1 |
| CAS |
60658-40-4 |
| Structure |
 |
| IUPAC Name |
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-henicosadeuterioundecanoic acid |
| Molecular Weight |
207.42 |
| Molecular Formula |
C12HD23O2 |
| InChI |
InChI=1S/C11H22O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h2-10H2,1H3,(H,12,13)/i1D3,2D2,3D2,4D2,5D2,6D2,7D2,8D2,9D2,10D2 |
| InChI Key |
ZDPHROOEEOARMN-SLBGAMDCSA-N |
| Boiling Point |
225 °C at 100 mm Hg (lit.) |
| Melting Point |
44-46 °C (lit.) |
| Chemical Formula |
CD3(CD2)9COOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
112-37-8 |
| Unlabeled Synonyms |
Hendecanoic acid |
