Undecanoic-11,11,11-d3 acid
| Catalog Number |
ACM1219802115 |
| CAS |
1219802-11-5 |
| IUPAC Name |
11,11,11-trideuterioundecanoic acid |
| Molecular Weight |
189.31 |
| Molecular Formula |
C11H19D3O2 |
| InChI |
InChI=1S/C11H22O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h2-10H2,1H3,(H,12,13)/i1D3 |
| InChI Key |
ZDPHROOEEOARMN-FIBGUPNXSA-N |
| Chemical Formula |
CD3(CH2)9COOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])CCCCCCCCCC(=O)O |
| Isotopic Enrichment |
99 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
112-37-8 |
| Unlabeled Synonyms |
Hendecanoic acid |
Please kindly note that our products and services are for research use only.
