Tyramine:HCl (1,1,2,2-D4)
| Catalog Number |
ACM1189884476-1 |
| CAS |
1189884-47-6 |
| Structure |
 |
| Synonyms |
Tyramine-d4 hydrochloride |
| IUPAC Name |
4-(2-amino-1,1,2,2-tetradeuterioethyl)phenol;hydrochloride |
| Molecular Weight |
177.66 |
| Molecular Formula |
C8H8D4ClNO |
| InChI |
InChI=1S/C8H11NO.ClH/c9-6-5-7-1-3-8(10)4-2-7;/h1-4,10H,5-6,9H2;1H/i5D2,6D2; |
| InChI Key |
RNISDHSYKZAWOK-NXMSQKFDSA-N |
| Melting Point |
271-274 °C (520-525 °F) (lit.) |
| Purity |
98% |
| Appearance |
Beige crystalline solid |
| Chemical Formula |
HOC6H4CD2CD2NH2·HCl |
| Isomeric SMILES |
[2H]C([2H])(C1=CC=C(C=C1)O)C([2H])([2H])N.Cl |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. |
| Unlabeled CAS |
60-19-5 |
| Unlabeled Synonyms |
Tyrosaminehydrochloride; 4-(2-Aminoethyl)phenolhydrochloride; 4-
Hydroxyphenethylaminehydrochloride |
Please kindly note that our products and services are for research use only.
