| Catalog Number |
ACM202656131-1 |
| CAS |
202656-13-1 |
| Structure |
 |
| Synonyms |
N,N,1,1,3,3-Hexadeuterio-1,3-dideuteriooxy-2-[dideuterio(Deuteriooxy)methyl]propan-2-amine |
| IUPAC Name |
N,N,1,1,3,3-hexadeuterio-1,3-dideuteriooxy-2-[dideuterio(deuteriooxy)methyl]propan-2-amine |
| Molecular Weight |
132.20 |
| Molecular Formula |
C4D11NO3 |
| InChI |
InChI=1S/C4H11NO3/c5-4(1-6,2-7)3-8/h6-8H,1-3,5H2/i1D2,2D2,3D2,6D,7D,8D/hD2 |
| InChI Key |
LENZDBCJOHFCAS-RNVFPDRBSA-N |
| Boiling Point |
219-220 °C at 10 mmHg (lit.) |
| Melting Point |
162-165 °C (lit.) |
| Density |
1.137 g/mL at 25 °C |
| Chemical Formula |
(DOCD2)3CND2 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])(C(C([2H])([2H])O[2H])(C([2H])([2H])O[2H])N([2H])[2H])O[2H] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| CAS (Unlabeled) |
77-86-1 |
| Synonyms (Unlabeled) |
Tris(hydroxylmethyl)aminomethane; 2-Amino-2-hydroxymethyl-1, 3-propanediol; THAM; Trisaminol; Tris Buffer |
