| Catalog Number |
ACM358731949 |
| CAS |
358731-94-9 |
| Synonyms |
[2H15]-Chlorotriphenylstannane |
| IUPAC Name |
tributyl(1,2,2-trideuterioethenyl)stannane |
| Molecular Weight |
400.55 |
| Molecular Formula |
C18ClD15Sn |
| Canonical SMILES |
C1=CC=C(C=C1)[Sn](C2=CC=CC=C2)(C3=CC=CC=C3)Cl |
| InChI |
InChI=1S/3C4H9.C2H3.Sn/c3*1-3-4-2;1-2;/h3*1,3-4H2,2H3;1H,2H2;/i;;;1D,2D2; |
| InChI Key |
QIWRFOJWQSSRJZ-VCDGHBDPSA-N |
| Boiling Point |
240 °C at 13.5 mmHg (lit.) |
| Melting Point |
108 °C (lit.) |
| Chemical Formula |
(C6D5)3SnCl |
| Exact Mass |
401.082581g/mol |
| Isomeric SMILES |
[2H]C(=C([2H])[Sn](CCCC)(CCCC)CCCC)[2H] |
| Isotopic Enrichment |
99 atom % D |
| Monoisotopic Mass |
401.082581g/mol |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
639-58-7 |
