| Catalog Number |
ACM362049454-1 |
| CAS |
362049-45-4 |
| Structure |
 |
| Synonyms |
Phen-3,5-d2-ol, 2,4,6-tri(methyl-d3)- (9CI) |
| IUPAC Name |
3,5-dideuterio-2,4,6-tris(trideuteriomethyl)phenol |
| Molecular Weight |
147.26 |
| Molecular Formula |
C9D11HO |
| Canonical SMILES |
[2H]c1c(c([2H])c(c(O)c1C([2H])([2H])[2H])C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI |
InChI=1S/C9H12O/c1-6-4-7(2)9(10)8(3)5-6/h4-5,10H,1-3H3/i1D3,2D3,3D3,4D,5D |
| InChI Key |
BPRYUXCVCCNUFE-JXCHDVSKSA-N |
| Purity |
98 atom % D |
| Accurate Mass |
147.1579 |
| Exact Mass |
147.15800 |
| Format |
Neat |
| Isotopic Enrichment |
98 atom % D |
| Packaging |
0.5 g
In Stock
1 g
In Stock |
| Shipping Hazards |
CORROSIVE |
| SIL Type |
Deuterium |
| Stability |
Stable if stored under recommended conditions (see section 7 of SDS). After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
527-60-6 |
