| Catalog Number |
ACM347841832-1 |
| CAS |
347841-83-2 |
| Structure |
 |
| Description |
2,3,6-Trimethylphenol-d11 is the deuterium labeled 2,3,6-Trimethylphenol. 2,3,6-Trimethylphenol, a chemical flavoring naturally found in coffee. |
| Synonyms |
3-Hydroxypseudocumene |
| IUPAC Name |
3,4-dideuterio-2,5,6-tris(trideuteriomethyl)phenol |
| Molecular Weight |
147.26 |
| Molecular Formula |
C9HD11O |
| Canonical SMILES |
OC(C(C([2H])([2H])[2H])=C([2H])C([2H])=C1C([2H])([2H])[2H])=C1C([2H])([2H])[2H] |
| InChI |
InChI=1S/C9H12O/c1-6-4-5-7(2)9(10)8(6)3/h4-5,10H,1-3H3/i1D3,2D3,3D3,4D,5D |
| InChI Key |
QQOMQLYQAXGHSU-JXCHDVSKSA-N |
| Purity |
98 atom % D |
| Storage |
Please store the product under the recommended conditions in the Certificate of Analysis. |
| Chemical Formula |
(CD3)3C6D2OH |
| Functional Group |
Alcohols & Phenols |
| Isomeric SMILES |
[2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])C([2H])([2H])[2H])O)C([2H])([2H])[2H])[2H] |
| Isotopic Enrichment |
98 atom % D |
| Packaging |
0.25 g
In Stock
0.5 g
In Stock |
| Shipping |
Room temperature in continental US; may vary elsewhere. |
| Shipping Hazards |
CORROSIVE |
| Stability |
Stable if stored under recommended conditions (see section 7 of SDS). After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
2416-94-6 |
| Unlabeled Synonyms |
3-Hydroxypseudocumene |
