2,3,5-Trimethylphenol-d11 (98 atom % D, min 98% Chemical Purity)
| Catalog Number |
ACM362049465-1 |
| CAS |
362049-46-5 |
| Structure |
 |
| IUPAC Name |
2,3,5-tris(methyl-d3)phen-4,6-d2-ol |
| Molecular Weight |
147.26 |
| Molecular Formula |
C9HD11O |
| Canonical SMILES |
OC1=C([2H])C(C([2H])([2H])[2H])=C([2H])C(C([2H])([2H])[2H])=C1C([2H])([2H])[2H] |
| InChI |
InChI=1S/C9H12O/c1-6-4-7(2)8(3)9(10)5-6/h4-5,10H,1-3H3/i1D3,2D3,3D3,4D,5D |
| Accurate Mass |
147.16 |
| Format |
Neat |
| SIL Type |
Deuterium |
| Unlabeled CAS |
697-82-5 |
Please kindly note that our products and services are for research use only.
