1,3,5-Trimethylbenzene-2,4,6-d3 (98 atom % D, min 98% Chemical Purity)
| Catalog Number |
ACM38574140-1 |
| CAS |
38574-14-0 |
| Structure |
 |
| Synonyms |
2,4,6-Trideutero-1,3,5-trimethylbenzene |
| IUPAC Name |
Benzene-1,3,5-d3, 2,4,6-trimethyl |
| Molecular Weight |
123.21 |
| Molecular Formula |
C9H9D3 |
| Canonical SMILES |
CC1=C([2H])C(C)=C([2H])C(C)=C1[2H] |
| InChI |
InChI=1S/C9H12/c1-7-4-8(2)6-9(3)5-7/h4-6H,1-3H3/i4D,5D,6D |
| Accurate Mass |
123.11 |
| Alternative CAS |
108-67-8 |
| Format |
Neat |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
