1,2,4-Trimethylbenzene-d12 (98 atom % D, min 98% Chemical Purity)
| Catalog Number |
ACM350818610-1 |
| CAS |
350818-61-0 |
| Structure |
 |
| Synonyms |
Perdeuterated 1,2,4-trimethylbenzene |
| IUPAC Name |
1,2,4-tris(methyl-d3)benzene-3,5,6-d3 |
| Molecular Weight |
132.27 |
| Molecular Formula |
C9D12 |
| Canonical SMILES |
[2H]C([2H])([2H])C1=C([2H])C([2H])=C(C([2H])([2H])[2H])C([2H])=C1C([2H])([2H])[2H] |
| InChI |
InChI=1S/C9H12/c1-7-4-5-8(2)9(3)6-7/h4-6H,1-3H3/i1D3,2D3,3D3,4D,5D,6D |
| Accurate Mass |
132.17 |
| Format |
Neat |
| SIL Type |
Deuterium |
| Unlabeled CAS |
95-63-6 |
Please kindly note that our products and services are for research use only.
