Trimethoprim D3 (4-methoxy D3)
| Catalog Number |
ACM1189923383-1 |
| CAS |
1189923-38-3 |
| Structure |
 |
| Synonyms |
Trimethoprim D3 (4-methoxy D3) |
| IUPAC Name |
5-[[3,5-dimethoxy-4-(trideuteriomethoxy)phenyl]methyl]pyrimidine-2,4-diamine |
| Molecular Weight |
297.364 |
| Molecular Formula |
C14D5H15N4O3 |
| Canonical SMILES |
[2H].[2H].[2H]C([2H])([2H])Oc1c(OC)cc(Cc2cnc(N)nc2N)cc1OC |
| InChI |
InChI=1S/C14H18N4O3.2H/c1-19-10-5-8(6-11(20-2)12(10)21-3)4-9-7-17-14(16)18-13(9)15;;/h5-7H,4H2,1-3H3,(H4,15,16,17,18);;/i3D3;2*1+1 |
| Storage |
+20 °C |
| Accurate Mass |
297.185 |
| Format |
Neat |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
| Unlabeled CAS |
738-70-5 |
Please kindly note that our products and services are for research use only.
