Trietazine D5 100 µg/mL in Acetone
| Catalog Number |
ACM1397243730-1 |
| CAS |
1397243-73-0 |
| Structure |
 |
| IUPAC Name |
6-chloro-2-N,2-N-diethyl-4-N-(1,1,2,2,2-pentadeuterioethyl)-1,3,5-triazine-2,4-diamine |
| Molecular Weight |
234.74 |
| Molecular Formula |
C9D5H11ClN5 |
| Canonical SMILES |
[2H]C([2H])([2H])C([2H])([2H])Nc1nc(Cl)nc(n1)N(CC)CC |
| InChI |
InChI=1S/C9H16ClN5/c1-4-11-8-12-7(10)13-9(14-8)15(5-2)6-3/h4-6H2,1-3H3,(H,11,12,13,14)/i1D3,4D2 |
| Storage |
+20 °C |
| Accurate Mass |
234.1408 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
