| Catalog Number |
ACM64118441-1 |
| CAS |
64118-44-1 |
| Structure |
 |
| IUPAC Name |
2,2-dideuteriotridecanoic acid |
| Molecular Weight |
216.36 |
| Molecular Formula |
C13H24D2O2 |
| InChI |
InChI=1S/C13H26O2/c1-2-3-4-5-6-7-8-9-10-11-12-13(14)15/h2-12H2,1H3,(H,14,15)/i12D2 |
| InChI Key |
SZHOJFHSIKHZHA-XUWBISKJSA-N |
| Boiling Point |
236 °C at 100 mmHg |
| Melting Point |
41-42 °C (lit.) |
| Flash Point |
113 °C |
| Chemical Formula |
CH3(CH2)10CD2COOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])(CCCCCCCCCCC)C(=O)O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
638-53-9 |
