| Catalog Number |
ACM93951805-1 |
| CAS |
93951-80-5 |
| Structure |
 |
| Synonyms |
Phen-3,5-d2-ol, 2,4,6-trichloro-, 2,4,6-Trichlorophen-3,5-d2-ol, 2,4,6-Trichlorophenol D2, 2,4,6-Trichlorophenol (ring-D2) |
| IUPAC Name |
2,4,6-trichloro-3,5-dideuteriophenol |
| Molecular Weight |
199.46 |
| Molecular Formula |
C6DDCl3O |
| Canonical SMILES |
[2H]c1c(Cl)c([2H])c(Cl)c(O)c1Cl |
| InChI |
InChI=1S/C6H3Cl3O/c7-3-1-4(8)6(10)5(9)2-3/h1-2,10H/i1D,2D |
| Purity |
98 atom % D |
| Accurate Mass |
197.9375 |
| Format |
Neat |
| Functional Group |
Alcohols & Phenols,Halides |
| Isotopic Enrichment |
98 atom % D |
| Packaging |
0.1 g
In Stock
0.25 g
In Stock |
| Shipping Hazards |
TOXIC (PGIII) |
| SIL Type |
Deuterium |
| Stability |
Stable if stored under recommended conditions (see section 7 of SDS). After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
88-06-2 |
