2,4,6-Trichloroanisole D5 100 µg/mL in Acetonitrile
| Catalog Number |
ACM352439088-2 |
| CAS |
352439-08-8 |
| Structure |
 |
| IUPAC Name |
1,3,5-trichloro-2,4-dideuterio-6-(trideuteriomethoxy)benzene |
| Molecular Weight |
216.5 |
| Molecular Formula |
C7D5Cl3O |
| Canonical SMILES |
[2H]c1c(Cl)c([2H])c(Cl)c(OC([2H])([2H])[2H])c1Cl |
| InChI |
InChI=1S/C7H5Cl3O/c1-11-7-5(9)2-4(8)3-6(7)10/h2-3H,1H3/i1D3,2D,3D |
| Storage |
+20 °C |
| Accurate Mass |
214.972 |
| Alternative CAS |
87-40-1 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
