trans-Permethrinic acid D6 (dimethyl D6) 100 µg/mL in Acetone
| Catalog Number |
ACM2714486163 |
| CAS |
2714486-16-3 |
| Structure |
 |
| Synonyms |
(E)-3-(2,2-Dichlorovinyl)-2,2-di(methyl D3)-(1-cyclopropane)carboxylic acid D6 |
| IUPAC Name |
(1R,3S)-3-(2,2-dichloroethenyl)-2,2-bis(trideuteriomethyl)cyclopropane-1-carboxylic acid |
| Molecular Weight |
215.11 |
| Molecular Formula |
C8D6H4Cl2O2 |
| Canonical SMILES |
[2H]C([2H])([2H])C1([C@H](C=C(Cl)Cl)[C@H]1C(=O)O)C([2H])([2H])[2H] |
| InChI |
InChI=1S/C8H10Cl2O2/c1-8(2)4(3-5(9)10)6(8)7(11)12/h3-4,6H,1-2H3,(H,11,12)/t4-,6+/m1/s1/i1D3,2D3 |
| Storage |
+20 °C |
| Accurate Mass |
214.0434 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
