trans-Permethrin D6 (dimethyl D6) 100 µg/mL in Acetone
| Catalog Number |
ACM82523599-2 |
| CAS |
82523-59-9 |
| Structure |
 |
| IUPAC Name |
(3-phenoxyphenyl)methyl (1R,3S)-3-(2,2-dichloroethenyl)-2,2-bis(trideuteriomethyl)cyclopropane-1-carboxylate |
| Molecular Weight |
397.32 |
| Molecular Formula |
C21D6H14Cl2O3 |
| Canonical SMILES |
[2H]C([2H])([2H])C1([C@H](C=C(Cl)Cl)[C@H]1C(=O)OCc2cccc(Oc3ccccc3)c2)C([2H])([2H])[2H] |
| InChI |
InChI=1S/C21H20Cl2O3/c1-21(2)17(12-18(22)23)19(21)20(24)25-13-14-7-6-10-16(11-14)26-15-8-4-3-5-9-15/h3-12,17,19H,13H2,1-2H3/t17-,19+/m1/s1/i1D3,2D3 |
| Storage |
+20 °C |
| Accurate Mass |
396.1166 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
