trans-Cypermethrin D6 (dimethyl D6) 100 µg/mL in Acetone
| Catalog Number |
ACM82523657-2 |
| CAS |
82523-65-7 |
| Structure |
 |
| IUPAC Name |
[cyano-(3-phenoxyphenyl)methyl] 3-(2,2-dichloroethenyl)-2,2-bis(trideuteriomethyl)cyclopropane-1-carboxylate |
| Molecular Weight |
422.33 |
| Molecular Formula |
C22D6H13Cl2NO3 |
| Canonical SMILES |
[2H]C([2H])([2H])C1(C(C=C(Cl)Cl)C1C(=O)OC(C#N)c2cccc(Oc3ccccc3)c2)C([2H])([2H])[2H] |
| InChI |
InChI=1S/C22H19Cl2NO3/c1-22(2)17(12-19(23)24)20(22)21(26)28-18(13-25)14-7-6-10-16(11-14)27-15-8-4-3-5-9-15/h3-12,17-18,20H,1-2H3/i1D3,2D3 |
| Storage |
-18 °C |
| Accurate Mass |
421.1119 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
